C18H19N3O4 — CID 18104274
3,5-diacetamido-N-(3-methoxyphenyl)benzamide (PubChem CID 18104274) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3,5-diacetamido-N-(3-methoxyphenyl)benzamide.
| Compound Name | 3,5-diacetamido-N-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 18104274 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3,5-diacetamido-N-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(NC(=O)c2cc(NC(C)=O)cc(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C18H19N3O4/c1-11(22)19-15-7-13(8-16(9-15)20-12(2)23)18(24)21-14-5-4-6-17(10-14)25-3/h4-10H,1-3H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | RKQLYSCLHSNJBH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |