C21H23FN2O5 — CID 55968285
tert-butyl N-[5-[[2-(3-acetylphenoxy)acetyl]amino]-2-fluorophenyl]carbamate (PubChem CID 55968285) has the molecular formula C21H23FN2O5 and a molecular weight of 402.42 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-(3-acetylphenoxy)acetyl]amino]-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-(3-acetylphenoxy)acetyl]amino]-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 55968285 |
| Molecular Formula | C21H23FN2O5 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | tert-butyl N-[5-[[2-(3-acetylphenoxy)acetyl]amino]-2-fluorophenyl]carbamate |
| SMILES | CC(=O)c1cccc(OCC(=O)Nc2ccc(F)c(NC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C21H23FN2O5/c1-13(25)14-6-5-7-16(10-14)28-12-19(26)23-15-8-9-17(22)18(11-15)24-20(27)29-21(2,3)4/h5-11H,12H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | FHNXEOILSKJSEP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |