C20H23FN2O4S — CID 55968162
tert-butyl N-[2-fluoro-5-[[2-(4-methoxyphenyl)sulfanylacetyl]amino]phenyl]carbamate (PubChem CID 55968162) has the molecular formula C20H23FN2O4S and a molecular weight of 406.48 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-5-[[2-(4-methoxyphenyl)sulfanylacetyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-5-[[2-(4-methoxyphenyl)sulfanylacetyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 55968162 |
| Molecular Formula | C20H23FN2O4S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | tert-butyl N-[2-fluoro-5-[[2-(4-methoxyphenyl)sulfanylacetyl]amino]phenyl]carbamate |
| SMILES | COc1ccc(SCC(=O)Nc2ccc(F)c(NC(=O)OC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C20H23FN2O4S/c1-20(2,3)27-19(25)23-17-11-13(5-10-16(17)21)22-18(24)12-28-15-8-6-14(26-4)7-9-15/h5-11H,12H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | BGJNQBZICWHTHI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |