C23H22FN3O4S — CID 55969188
tert-butyl N-[2-fluoro-5-[[2-(thiophene-3-carbonylamino)benzoyl]amino]phenyl]carbamate (PubChem CID 55969188) has the molecular formula C23H22FN3O4S and a molecular weight of 455.51 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-5-[[2-(thiophene-3-carbonylamino)benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-5-[[2-(thiophene-3-carbonylamino)benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 55969188 |
| Molecular Formula | C23H22FN3O4S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | tert-butyl N-[2-fluoro-5-[[2-(thiophene-3-carbonylamino)benzoyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NC(=O)c2ccccc2NC(=O)c2ccsc2)ccc1F |
| InChI | InChI=1S/C23H22FN3O4S/c1-23(2,3)31-22(30)27-19-12-15(8-9-17(19)24)25-21(29)16-6-4-5-7-18(16)26-20(28)14-10-11-32-13-14/h4-13H,1-3H3,(H,25,29)(H,26,28)(H,27,30) |
| InChIKey | IPIWQQUEOJCNGA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |