C20H23FN2O3S — CID 86930596
tert-butyl N-[4-fluoro-3-[[4-(methylsulfanylmethyl)benzoyl]amino]phenyl]carbamate (PubChem CID 86930596) has the molecular formula C20H23FN2O3S and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl N-[4-fluoro-3-[[4-(methylsulfanylmethyl)benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-fluoro-3-[[4-(methylsulfanylmethyl)benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 86930596 |
| Molecular Formula | C20H23FN2O3S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | tert-butyl N-[4-fluoro-3-[[4-(methylsulfanylmethyl)benzoyl]amino]phenyl]carbamate |
| SMILES | CSCc1ccc(C(=O)Nc2cc(NC(=O)OC(C)(C)C)ccc2F)cc1 |
| InChI | InChI=1S/C20H23FN2O3S/c1-20(2,3)26-19(25)22-15-9-10-16(21)17(11-15)23-18(24)14-7-5-13(6-8-14)12-27-4/h5-11H,12H2,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | GLIFNCVYZNJBFU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |