C21H25FN2O4 — CID 86938109
tert-butyl N-[3-[(4-ethoxy-3-methylbenzoyl)amino]-4-fluorophenyl]carbamate (PubChem CID 86938109) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-ethoxy-3-methylbenzoyl)amino]-4-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(4-ethoxy-3-methylbenzoyl)amino]-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 86938109 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | tert-butyl N-[3-[(4-ethoxy-3-methylbenzoyl)amino]-4-fluorophenyl]carbamate |
| SMILES | CCOc1ccc(C(=O)Nc2cc(NC(=O)OC(C)(C)C)ccc2F)cc1C |
| InChI | InChI=1S/C21H25FN2O4/c1-6-27-18-10-7-14(11-13(18)2)19(25)24-17-12-15(8-9-16(17)22)23-20(26)28-21(3,4)5/h7-12H,6H2,1-5H3,(H,23,26)(H,24,25) |
| InChIKey | SZSLJUSPYXQGII-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |