C15H12F2N2O3 — CID 137353520
[4-fluoro-3-[(4-fluoro-3-methylbenzoyl)amino]phenyl]carbamic acid (PubChem CID 137353520) has the molecular formula C15H12F2N2O3 and a molecular weight of 306.27 g/mol. Its IUPAC name is [4-fluoro-3-[(4-fluoro-3-methylbenzoyl)amino]phenyl]carbamic acid.
| Compound Name | [4-fluoro-3-[(4-fluoro-3-methylbenzoyl)amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 137353520 |
| Molecular Formula | C15H12F2N2O3 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [4-fluoro-3-[(4-fluoro-3-methylbenzoyl)amino]phenyl]carbamic acid |
| SMILES | Cc1cc(C(=O)Nc2cc(NC(=O)O)ccc2F)ccc1F |
| InChI | InChI=1S/C15H12F2N2O3/c1-8-6-9(2-4-11(8)16)14(20)19-13-7-10(18-15(21)22)3-5-12(13)17/h2-7,18H,1H3,(H,19,20)(H,21,22) |
| InChIKey | DWFORBWVOBMBTQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |