C17H25FN2O2 — CID 107240679
tert-butyl N-[5-(cyclohexylamino)-2-fluorophenyl]carbamate (PubChem CID 107240679) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is tert-butyl N-[5-(cyclohexylamino)-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-(cyclohexylamino)-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 107240679 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | tert-butyl N-[5-(cyclohexylamino)-2-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(NC2CCCCC2)ccc1F |
| InChI | InChI=1S/C17H25FN2O2/c1-17(2,3)22-16(21)20-15-11-13(9-10-14(15)18)19-12-7-5-4-6-8-12/h9-12,19H,4-8H2,1-3H3,(H,20,21) |
| InChIKey | OBGRCKAWMNSJGO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |