C17H26N2O4 — CID 104870570
tert-butyl N-[2-methoxy-4-[(3-methoxycyclobutyl)amino]phenyl]carbamate (PubChem CID 104870570) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl N-[2-methoxy-4-[(3-methoxycyclobutyl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-methoxy-4-[(3-methoxycyclobutyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 104870570 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl N-[2-methoxy-4-[(3-methoxycyclobutyl)amino]phenyl]carbamate |
| SMILES | COc1cc(NC2CC(OC)C2)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N2O4/c1-17(2,3)23-16(20)19-14-7-6-11(10-15(14)22-5)18-12-8-13(9-12)21-4/h6-7,10,12-13,18H,8-9H2,1-5H3,(H,19,20) |
| InChIKey | ARYIKDHUTGOSTL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |