C16H25N3O3 — CID 107239640
tert-butyl N-[5-[(3-aminocyclobutyl)amino]-2-methoxyphenyl]carbamate (PubChem CID 107239640) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl N-[5-[(3-aminocyclobutyl)amino]-2-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[5-[(3-aminocyclobutyl)amino]-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 107239640 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | tert-butyl N-[5-[(3-aminocyclobutyl)amino]-2-methoxyphenyl]carbamate |
| SMILES | COc1ccc(NC2CC(N)C2)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25N3O3/c1-16(2,3)22-15(20)19-13-9-11(5-6-14(13)21-4)18-12-7-10(17)8-12/h5-6,9-10,12,18H,7-8,17H2,1-4H3,(H,19,20) |
| InChIKey | TZYFQCAQGULNNQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|