C15H25N3O3 — CID 107239656
tert-butyl N-[5-(1-aminopropan-2-ylamino)-2-methoxyphenyl]carbamate (PubChem CID 107239656) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl N-[5-(1-aminopropan-2-ylamino)-2-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[5-(1-aminopropan-2-ylamino)-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 107239656 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | tert-butyl N-[5-(1-aminopropan-2-ylamino)-2-methoxyphenyl]carbamate |
| SMILES | COc1ccc(NC(C)CN)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N3O3/c1-10(9-16)17-11-6-7-13(20-5)12(8-11)18-14(19)21-15(2,3)4/h6-8,10,17H,9,16H2,1-5H3,(H,18,19) |
| InChIKey | AKUBMWPATMFPPO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|