C15H24BrNO3 — CID 144536105
tert-butyl N-(5-bromo-2-methoxyphenyl)carbamate;propane (PubChem CID 144536105) has the molecular formula C15H24BrNO3 and a molecular weight of 346.27 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-2-methoxyphenyl)carbamate;propane.
| Compound Name | tert-butyl N-(5-bromo-2-methoxyphenyl)carbamate;propane |
|---|---|
| PubChem CID | 144536105 |
| Molecular Formula | C15H24BrNO3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | tert-butyl N-(5-bromo-2-methoxyphenyl)carbamate;propane |
| SMILES | CCC.COc1ccc(Br)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H16BrNO3.C3H8/c1-12(2,3)17-11(15)14-9-7-8(13)5-6-10(9)16-4;1-3-2/h5-7H,1-4H3,(H,14,15);3H2,1-2H3 |
| InChIKey | BJSSWQJNMVYTTI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |