C10H12BrNO4 — CID 79349776
2-hydroxyethyl N-(5-bromo-2-methoxyphenyl)carbamate (PubChem CID 79349776) has the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. Its IUPAC name is 2-hydroxyethyl N-(5-bromo-2-methoxyphenyl)carbamate.
| Compound Name | 2-hydroxyethyl N-(5-bromo-2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 79349776 |
| Molecular Formula | C10H12BrNO4 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 2-hydroxyethyl N-(5-bromo-2-methoxyphenyl)carbamate |
| SMILES | COc1ccc(Br)cc1NC(=O)OCCO |
| InChI | InChI=1S/C10H12BrNO4/c1-15-9-3-2-7(11)6-8(9)12-10(14)16-5-4-13/h2-3,6,13H,4-5H2,1H3,(H,12,14) |
| InChIKey | KRAGPUKYKIBNJP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |