C10H12FNO4 — CID 79349865
2-hydroxyethyl N-(4-fluoro-2-methoxyphenyl)carbamate (PubChem CID 79349865) has the molecular formula C10H12FNO4 and a molecular weight of 229.21 g/mol. Its IUPAC name is 2-hydroxyethyl N-(4-fluoro-2-methoxyphenyl)carbamate.
| Compound Name | 2-hydroxyethyl N-(4-fluoro-2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 79349865 |
| Molecular Formula | C10H12FNO4 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 2-hydroxyethyl N-(4-fluoro-2-methoxyphenyl)carbamate |
| SMILES | COc1cc(F)ccc1NC(=O)OCCO |
| InChI | InChI=1S/C10H12FNO4/c1-15-9-6-7(11)2-3-8(9)12-10(14)16-5-4-13/h2-3,6,13H,4-5H2,1H3,(H,12,14) |
| InChIKey | BBQPLWQVVPGXHT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |