C19H23FN2O3 — CID 10247026
propyl N-[4-[(4-fluorophenyl)methyl-methylamino]-2-methoxyphenyl]carbamate (PubChem CID 10247026) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is propyl N-[4-[(4-fluorophenyl)methyl-methylamino]-2-methoxyphenyl]carbamate.
| Compound Name | propyl N-[4-[(4-fluorophenyl)methyl-methylamino]-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 10247026 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | propyl N-[4-[(4-fluorophenyl)methyl-methylamino]-2-methoxyphenyl]carbamate |
| SMILES | CCCOC(=O)Nc1ccc(N(C)Cc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C19H23FN2O3/c1-4-11-25-19(23)21-17-10-9-16(12-18(17)24-3)22(2)13-14-5-7-15(20)8-6-14/h5-10,12H,4,11,13H2,1-3H3,(H,21,23) |
| InChIKey | FCHLJBHFHBTVKP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |