C22H28FN3O2 — CID 67266931
1-[2-cyclopentyloxy-4-[(4-fluorophenyl)methyl-methylamino]phenyl]-3-ethylurea (PubChem CID 67266931) has the molecular formula C22H28FN3O2 and a molecular weight of 385.48 g/mol. Its IUPAC name is 1-[2-cyclopentyloxy-4-[(4-fluorophenyl)methyl-methylamino]phenyl]-3-ethylurea.
| Compound Name | 1-[2-cyclopentyloxy-4-[(4-fluorophenyl)methyl-methylamino]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 67266931 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 1-[2-cyclopentyloxy-4-[(4-fluorophenyl)methyl-methylamino]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc(N(C)Cc2ccc(F)cc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C22H28FN3O2/c1-3-24-22(27)25-20-13-12-18(14-21(20)28-19-6-4-5-7-19)26(2)15-16-8-10-17(23)11-9-16/h8-14,19H,3-7,15H2,1-2H3,(H2,24,25,27) |
| InChIKey | XXORMBACYMRYFK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |