C18H27FN2O4 — CID 118242693
tert-butyl N-[3-[5-fluoro-2-(hydroxyamino)phenoxy]cyclohexyl]-N-methylcarbamate (PubChem CID 118242693) has the molecular formula C18H27FN2O4 and a molecular weight of 354.42 g/mol. Its IUPAC name is tert-butyl N-[3-[5-fluoro-2-(hydroxyamino)phenoxy]cyclohexyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[5-fluoro-2-(hydroxyamino)phenoxy]cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118242693 |
| Molecular Formula | C18H27FN2O4 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | tert-butyl N-[3-[5-fluoro-2-(hydroxyamino)phenoxy]cyclohexyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCCC(Oc2cc(F)ccc2NO)C1 |
| InChI | InChI=1S/C18H27FN2O4/c1-18(2,3)25-17(22)21(4)13-6-5-7-14(11-13)24-16-10-12(19)8-9-15(16)20-23/h8-10,13-14,20,23H,5-7,11H2,1-4H3 |
| InChIKey | ACAADRRQOMVCFZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|