C12H16FNO4 — CID 88900498
cis-(1S,3R)-5-[5-fluoro-2-(hydroxyamino)phenoxy]cyclohexane-1,3-diol (PubChem CID 88900498) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is cis-(1S,3R)-5-[5-fluoro-2-(hydroxyamino)phenoxy]cyclohexane-1,3-diol.
| Compound Name | cis-(1S,3R)-5-[5-fluoro-2-(hydroxyamino)phenoxy]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 88900498 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | cis-(1S,3R)-5-[5-fluoro-2-(hydroxyamino)phenoxy]cyclohexane-1,3-diol |
| SMILES | ONc1ccc(F)cc1OC1C[C@@H](O)C[C@@H](O)C1 |
| InChI | InChI=1S/C12H16FNO4/c13-7-1-2-11(14-17)12(3-7)18-10-5-8(15)4-9(16)6-10/h1-3,8-10,14-17H,4-6H2/t8-,9+,10? |
| InChIKey | LVWULHXMYAHYEI-ULKQDVFKSA-N |
| XLogP | 1.28 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|