C11H12FNO5 — CID 76781849
4-(5-fluoro-2-nitrophenoxy)cyclopentane-1,2-diol (PubChem CID 76781849) has the molecular formula C11H12FNO5 and a molecular weight of 257.22 g/mol. Its IUPAC name is 4-(5-fluoro-2-nitrophenoxy)cyclopentane-1,2-diol.
| Compound Name | 4-(5-fluoro-2-nitrophenoxy)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 76781849 |
| Molecular Formula | C11H12FNO5 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-(5-fluoro-2-nitrophenoxy)cyclopentane-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc(F)cc1OC1CC(O)C(O)C1 |
| InChI | InChI=1S/C11H12FNO5/c12-6-1-2-8(13(16)17)11(3-6)18-7-4-9(14)10(15)5-7/h1-3,7,9-10,14-15H,4-5H2 |
| InChIKey | HVMMELFSECHNMP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|