C11H10FNO5 — CID 51923988
(3S,5S)-3-(5-fluoro-2-nitrophenoxy)-5-methyloxolan-2-one (PubChem CID 51923988) has the molecular formula C11H10FNO5 and a molecular weight of 255.20 g/mol. Its IUPAC name is (3S,5S)-3-(5-fluoro-2-nitrophenoxy)-5-methyloxolan-2-one.
| Compound Name | (3S,5S)-3-(5-fluoro-2-nitrophenoxy)-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 51923988 |
| Molecular Formula | C11H10FNO5 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | (3S,5S)-3-(5-fluoro-2-nitrophenoxy)-5-methyloxolan-2-one |
| SMILES | C[C@H]1C[C@H](Oc2cc(F)ccc2[N+](=O)[O-])C(=O)O1 |
| InChI | InChI=1S/C11H10FNO5/c1-6-4-10(11(14)17-6)18-9-5-7(12)2-3-8(9)13(15)16/h2-3,5-6,10H,4H2,1H3/t6-,10-/m0/s1 |
| InChIKey | BNYDYHYCISOEPY-WKEGUHRASA-N |
| XLogP | 1.82 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|