C14H18FNO4 — CID 66367092
2,2-diethyl-3-(5-fluoro-2-nitrophenoxy)cyclobutan-1-ol (PubChem CID 66367092) has the molecular formula C14H18FNO4 and a molecular weight of 283.30 g/mol. Its IUPAC name is 2,2-diethyl-3-(5-fluoro-2-nitrophenoxy)cyclobutan-1-ol.
| Compound Name | 2,2-diethyl-3-(5-fluoro-2-nitrophenoxy)cyclobutan-1-ol |
|---|---|
| PubChem CID | 66367092 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2,2-diethyl-3-(5-fluoro-2-nitrophenoxy)cyclobutan-1-ol |
| SMILES | CCC1(CC)C(O)CC1Oc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18FNO4/c1-3-14(4-2)12(17)8-13(14)20-11-7-9(15)5-6-10(11)16(18)19/h5-7,12-13,17H,3-4,8H2,1-2H3 |
| InChIKey | LUXCZUGJMTXCDU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|