C15H21NO5 — CID 102703796
2,2-diethyl-3-(5-methoxy-2-nitrophenoxy)cyclobutan-1-ol (PubChem CID 102703796) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 2,2-diethyl-3-(5-methoxy-2-nitrophenoxy)cyclobutan-1-ol.
| Compound Name | 2,2-diethyl-3-(5-methoxy-2-nitrophenoxy)cyclobutan-1-ol |
|---|---|
| PubChem CID | 102703796 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2,2-diethyl-3-(5-methoxy-2-nitrophenoxy)cyclobutan-1-ol |
| SMILES | CCC1(CC)C(O)CC1Oc1cc(OC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21NO5/c1-4-15(5-2)13(17)9-14(15)21-12-8-10(20-3)6-7-11(12)16(18)19/h6-8,13-14,17H,4-5,9H2,1-3H3 |
| InChIKey | LOFKIWADYMBZEH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|