C15H20ClNO4 — CID 66345076
2-(3-chloro-2,2-diethylcyclobutyl)oxy-1-methoxy-4-nitrobenzene (PubChem CID 66345076) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 2-(3-chloro-2,2-diethylcyclobutyl)oxy-1-methoxy-4-nitrobenzene.
| Compound Name | 2-(3-chloro-2,2-diethylcyclobutyl)oxy-1-methoxy-4-nitrobenzene |
|---|---|
| PubChem CID | 66345076 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-(3-chloro-2,2-diethylcyclobutyl)oxy-1-methoxy-4-nitrobenzene |
| SMILES | CCC1(CC)C(Cl)CC1Oc1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C15H20ClNO4/c1-4-15(5-2)13(16)9-14(15)21-12-8-10(17(18)19)6-7-11(12)20-3/h6-8,13-14H,4-5,9H2,1-3H3 |
| InChIKey | SCTPSHUYXZJHFU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|