C12H13BrClNO3 — CID 103013125
1-bromo-2-(3-chloro-2,2-dimethylcyclobutyl)oxy-4-nitrobenzene (PubChem CID 103013125) has the molecular formula C12H13BrClNO3 and a molecular weight of 334.60 g/mol. Its IUPAC name is 1-bromo-2-(3-chloro-2,2-dimethylcyclobutyl)oxy-4-nitrobenzene.
| Compound Name | 1-bromo-2-(3-chloro-2,2-dimethylcyclobutyl)oxy-4-nitrobenzene |
|---|---|
| PubChem CID | 103013125 |
| Molecular Formula | C12H13BrClNO3 |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 1-bromo-2-(3-chloro-2,2-dimethylcyclobutyl)oxy-4-nitrobenzene |
| SMILES | CC1(C)C(Cl)CC1Oc1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C12H13BrClNO3/c1-12(2)10(14)6-11(12)18-9-5-7(15(16)17)3-4-8(9)13/h3-5,10-11H,6H2,1-2H3 |
| InChIKey | ZKRZVVJIYZQHQJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|