C14H16BrNO4 — CID 103013102
3-(2-bromo-5-nitrophenoxy)-2,2-diethylcyclobutan-1-one (PubChem CID 103013102) has the molecular formula C14H16BrNO4 and a molecular weight of 342.19 g/mol. Its IUPAC name is 3-(2-bromo-5-nitrophenoxy)-2,2-diethylcyclobutan-1-one.
| Compound Name | 3-(2-bromo-5-nitrophenoxy)-2,2-diethylcyclobutan-1-one |
|---|---|
| PubChem CID | 103013102 |
| Molecular Formula | C14H16BrNO4 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 3-(2-bromo-5-nitrophenoxy)-2,2-diethylcyclobutan-1-one |
| SMILES | CCC1(CC)C(=O)CC1Oc1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C14H16BrNO4/c1-3-14(4-2)12(17)8-13(14)20-11-7-9(16(18)19)5-6-10(11)15/h5-7,13H,3-4,8H2,1-2H3 |
| InChIKey | WRFFGJIBPLRUBX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|