C14H17NO3 — CID 81416538
2,2-diethyl-3-(4-nitrophenyl)cyclobutan-1-one (PubChem CID 81416538) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2,2-diethyl-3-(4-nitrophenyl)cyclobutan-1-one.
| Compound Name | 2,2-diethyl-3-(4-nitrophenyl)cyclobutan-1-one |
|---|---|
| PubChem CID | 81416538 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2,2-diethyl-3-(4-nitrophenyl)cyclobutan-1-one |
| SMILES | CCC1(CC)C(=O)CC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H17NO3/c1-3-14(4-2)12(9-13(14)16)10-5-7-11(8-6-10)15(17)18/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | GQSNLMAMZCCFNA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|