C19H20N3O5+ — CID 7392901
(2R,3R,6S)-3-ethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-one (PubChem CID 7392901) has the molecular formula C19H20N3O5+ and a molecular weight of 370.39 g/mol. Its IUPAC name is (2R,3R,6S)-3-ethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-one.
| Compound Name | (2R,3R,6S)-3-ethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-one |
|---|---|
| PubChem CID | 7392901 |
| Molecular Formula | C19H20N3O5+ |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2R,3R,6S)-3-ethyl-2,6-bis(4-nitrophenyl)piperidin-1-ium-4-one |
| SMILES | CC[C@H]1C(=O)C[C@@H](c2ccc([N+](=O)[O-])cc2)[NH2+]C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N3O5/c1-2-16-18(23)11-17(12-3-7-14(8-4-12)21(24)25)20-19(16)13-5-9-15(10-6-13)22(26)27/h3-10,16-17,19-20H,2,11H2,1H3/p+1/t16-,17-,19?/m0/s1 |
| InChIKey | HWXXVUJFLTWVEW-YGYNJSFOSA-O |
| XLogP | 2.85 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|