C14H13NO5 — CID 141454273
5-acetyl-6-methyl-4-(4-nitrophenyl)-3,4-dihydropyran-2-one (PubChem CID 141454273) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 5-acetyl-6-methyl-4-(4-nitrophenyl)-3,4-dihydropyran-2-one.
| Compound Name | 5-acetyl-6-methyl-4-(4-nitrophenyl)-3,4-dihydropyran-2-one |
|---|---|
| PubChem CID | 141454273 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-acetyl-6-methyl-4-(4-nitrophenyl)-3,4-dihydropyran-2-one |
| SMILES | CC(=O)C1=C(C)OC(=O)CC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H13NO5/c1-8(16)14-9(2)20-13(17)7-12(14)10-3-5-11(6-4-10)15(18)19/h3-6,12H,7H2,1-2H3 |
| InChIKey | XYVYGXPUHRIONQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|