C12H11NO4 — CID 72760820
6-methyl-2-(4-nitrophenyl)-2,3-dihydropyran-4-one (PubChem CID 72760820) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 6-methyl-2-(4-nitrophenyl)-2,3-dihydropyran-4-one.
| Compound Name | 6-methyl-2-(4-nitrophenyl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 72760820 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 6-methyl-2-(4-nitrophenyl)-2,3-dihydropyran-4-one |
| SMILES | CC1=CC(=O)CC(c2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C12H11NO4/c1-8-6-11(14)7-12(17-8)9-2-4-10(5-3-9)13(15)16/h2-6,12H,7H2,1H3 |
| InChIKey | PIBHWEYJRBUHDP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|