C16H15NO3 — CID 15425708
(1S,3R)-1-methyl-3-(4-nitrophenyl)-3,4-dihydro-1H-isochromene (PubChem CID 15425708) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (1S,3R)-1-methyl-3-(4-nitrophenyl)-3,4-dihydro-1H-isochromene.
| Compound Name | (1S,3R)-1-methyl-3-(4-nitrophenyl)-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 15425708 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (1S,3R)-1-methyl-3-(4-nitrophenyl)-3,4-dihydro-1H-isochromene |
| SMILES | C[C@@H]1O[C@@H](c2ccc([N+](=O)[O-])cc2)Cc2ccccc21 |
| InChI | InChI=1S/C16H15NO3/c1-11-15-5-3-2-4-13(15)10-16(20-11)12-6-8-14(9-7-12)17(18)19/h2-9,11,16H,10H2,1H3/t11-,16+/m0/s1 |
| InChIKey | GDDKYCAGXJXFHO-MEDUHNTESA-N |
| XLogP | 3.97 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|