C16H16N2O4 — CID 765982
(2R,5S)-2-(2-methoxyphenyl)-5-(4-nitrophenyl)-1,3-oxazolidine (PubChem CID 765982) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is (2R,5S)-2-(2-methoxyphenyl)-5-(4-nitrophenyl)-1,3-oxazolidine.
| Compound Name | (2R,5S)-2-(2-methoxyphenyl)-5-(4-nitrophenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 765982 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (2R,5S)-2-(2-methoxyphenyl)-5-(4-nitrophenyl)-1,3-oxazolidine |
| SMILES | COc1ccccc1[C@@H]1NC[C@H](c2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C16H16N2O4/c1-21-14-5-3-2-4-13(14)16-17-10-15(22-16)11-6-8-12(9-7-11)18(19)20/h2-9,15-17H,10H2,1H3/t15-,16-/m1/s1 |
| InChIKey | RUPFSSOHHXJTKI-HZPDHXFCSA-N |
| XLogP | 2.96 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|