C16H14N2O4 — CID 102323795
(2S,6S)-2-(4-nitrophenyl)-6-phenyl-1,3-oxazinan-4-one (PubChem CID 102323795) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is (2S,6S)-2-(4-nitrophenyl)-6-phenyl-1,3-oxazinan-4-one.
| Compound Name | (2S,6S)-2-(4-nitrophenyl)-6-phenyl-1,3-oxazinan-4-one |
|---|---|
| PubChem CID | 102323795 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (2S,6S)-2-(4-nitrophenyl)-6-phenyl-1,3-oxazinan-4-one |
| SMILES | O=C1C[C@@H](c2ccccc2)O[C@@H](c2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C16H14N2O4/c19-15-10-14(11-4-2-1-3-5-11)22-16(17-15)12-6-8-13(9-7-12)18(20)21/h1-9,14,16H,10H2,(H,17,19)/t14-,16-/m0/s1 |
| InChIKey | NSYYGIYGZGNOAT-HOCLYGCPSA-N |
| XLogP | 2.87 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|