C24H17N3O6 — CID 102122615
2-[6-(4-nitrophenyl)-4-oxo-2-phenyl-1,3-oxazinan-5-yl]isoindole-1,3-dione (PubChem CID 102122615) has the molecular formula C24H17N3O6 and a molecular weight of 443.42 g/mol. Its IUPAC name is 2-[6-(4-nitrophenyl)-4-oxo-2-phenyl-1,3-oxazinan-5-yl]isoindole-1,3-dione.
| Compound Name | 2-[6-(4-nitrophenyl)-4-oxo-2-phenyl-1,3-oxazinan-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102122615 |
| Molecular Formula | C24H17N3O6 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-[6-(4-nitrophenyl)-4-oxo-2-phenyl-1,3-oxazinan-5-yl]isoindole-1,3-dione |
| SMILES | O=C1NC(c2ccccc2)OC(c2ccc([N+](=O)[O-])cc2)C1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H17N3O6/c28-21-19(26-23(29)17-8-4-5-9-18(17)24(26)30)20(14-10-12-16(13-11-14)27(31)32)33-22(25-21)15-6-2-1-3-7-15/h1-13,19-20,22H,(H,25,28) |
| InChIKey | SKKXKTQMFQOVFK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|