C22H18N2O6 — CID 100817075
(2R,4S,6S)-2,4-bis(4-nitrophenyl)-6-phenyl-1,3-dioxane (PubChem CID 100817075) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is (2R,4S,6S)-2,4-bis(4-nitrophenyl)-6-phenyl-1,3-dioxane.
| Compound Name | (2R,4S,6S)-2,4-bis(4-nitrophenyl)-6-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 100817075 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (2R,4S,6S)-2,4-bis(4-nitrophenyl)-6-phenyl-1,3-dioxane |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2O[C@H](c3ccccc3)C[C@@H](c3ccc([N+](=O)[O-])cc3)O2)cc1 |
| InChI | InChI=1S/C22H18N2O6/c25-23(26)18-10-6-16(7-11-18)21-14-20(15-4-2-1-3-5-15)29-22(30-21)17-8-12-19(13-9-17)24(27)28/h1-13,20-22H,14H2/t20-,21-,22+/m0/s1 |
| InChIKey | YJASYVLTQWVUMA-FDFHNCONSA-N |
| XLogP | 5.42 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|