C28H24N4O4 — CID 101127745
1,4-bis(4-nitrophenyl)-2,5-diphenylpiperazine (PubChem CID 101127745) has the molecular formula C28H24N4O4 and a molecular weight of 480.52 g/mol. Its IUPAC name is 1,4-bis(4-nitrophenyl)-2,5-diphenylpiperazine.
| Compound Name | 1,4-bis(4-nitrophenyl)-2,5-diphenylpiperazine |
|---|---|
| PubChem CID | 101127745 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 1,4-bis(4-nitrophenyl)-2,5-diphenylpiperazine |
| SMILES | O=[N+]([O-])c1ccc(N2CC(c3ccccc3)N(c3ccc([N+](=O)[O-])cc3)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N4O4/c33-31(34)25-15-11-23(12-16-25)29-20-28(22-9-5-2-6-10-22)30(19-27(29)21-7-3-1-4-8-21)24-13-17-26(18-14-24)32(35)36/h1-18,27-28H,19-20H2 |
| InChIKey | ZAJLUBQPNOLKGF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|