C16H13N3O2 — CID 102576559
(2R,3R)-2-(4-nitrophenyl)-1-phenylazetidine-3-carbonitrile (PubChem CID 102576559) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is (2R,3R)-2-(4-nitrophenyl)-1-phenylazetidine-3-carbonitrile.
| Compound Name | (2R,3R)-2-(4-nitrophenyl)-1-phenylazetidine-3-carbonitrile |
|---|---|
| PubChem CID | 102576559 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (2R,3R)-2-(4-nitrophenyl)-1-phenylazetidine-3-carbonitrile |
| SMILES | N#C[C@@H]1CN(c2ccccc2)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H13N3O2/c17-10-13-11-18(14-4-2-1-3-5-14)16(13)12-6-8-15(9-7-12)19(20)21/h1-9,13,16H,11H2/t13-,16+/m1/s1 |
| InChIKey | UZOVLBWDZHDDSS-CJNGLKHVSA-N |
| XLogP | 3.30 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|