C20H17N5O3 — CID 10384845
6-(4-nitrophenyl)-2,4-diphenyl-1,2,4,5-tetrazinan-3-one (PubChem CID 10384845) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-2,4-diphenyl-1,2,4,5-tetrazinan-3-one.
| Compound Name | 6-(4-nitrophenyl)-2,4-diphenyl-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 10384845 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 6-(4-nitrophenyl)-2,4-diphenyl-1,2,4,5-tetrazinan-3-one |
| SMILES | O=C1N(c2ccccc2)NC(c2ccc([N+](=O)[O-])cc2)NN1c1ccccc1 |
| InChI | InChI=1S/C20H17N5O3/c26-20-23(16-7-3-1-4-8-16)21-19(15-11-13-18(14-12-15)25(27)28)22-24(20)17-9-5-2-6-10-17/h1-14,19,21-22H |
| InChIKey | JTTSBOGSZWEIBP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|