C16H17N5O4 — CID 134916947
6-(4-methoxyphenyl)-2-methyl-4-(4-nitrophenyl)-1,2,4,5-tetrazinan-3-one (PubChem CID 134916947) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-2-methyl-4-(4-nitrophenyl)-1,2,4,5-tetrazinan-3-one.
| Compound Name | 6-(4-methoxyphenyl)-2-methyl-4-(4-nitrophenyl)-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 134916947 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 6-(4-methoxyphenyl)-2-methyl-4-(4-nitrophenyl)-1,2,4,5-tetrazinan-3-one |
| SMILES | COc1ccc(C2NN(C)C(=O)N(c3ccc([N+](=O)[O-])cc3)N2)cc1 |
| InChI | InChI=1S/C16H17N5O4/c1-19-16(22)20(12-5-7-13(8-6-12)21(23)24)18-15(17-19)11-3-9-14(25-2)10-4-11/h3-10,15,17-18H,1-2H3 |
| InChIKey | NYLNKCUBFHBKGX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|