C20H22F3N3O6S — CID 10767348
[(3S,4S)-4-(4-methoxyphenyl)-3-methyl-1-(4-nitrophenyl)azetidin-2-ylidene]-dimethylazanium;trifluoromethanesulfonate (PubChem CID 10767348) has the molecular formula C20H22F3N3O6S and a molecular weight of 489.47 g/mol. Its IUPAC name is [(3S,4S)-4-(4-methoxyphenyl)-3-methyl-1-(4-nitrophenyl)azetidin-2-ylidene]-dimethylazanium;trifluoromethanesulfonate.
| Compound Name | [(3S,4S)-4-(4-methoxyphenyl)-3-methyl-1-(4-nitrophenyl)azetidin-2-ylidene]-dimethylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10767348 |
| Molecular Formula | C20H22F3N3O6S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | [(3S,4S)-4-(4-methoxyphenyl)-3-methyl-1-(4-nitrophenyl)azetidin-2-ylidene]-dimethylazanium;trifluoromethanesulfonate |
| SMILES | COc1ccc([C@@H]2[C@H](C)C(=[N+](C)C)N2c2ccc([N+](=O)[O-])cc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C19H22N3O3.CHF3O3S/c1-13-18(14-5-11-17(25-4)12-6-14)21(19(13)20(2)3)15-7-9-16(10-8-15)22(23)24;2-1(3,4)8(5,6)7/h5-13,18H,1-4H3;(H,5,6,7)/q+1;/p-1/t13-,18-;/m0./s1 |
| InChIKey | BEUKWJWFNUZQNM-ZYJMRSDMSA-M |
| XLogP | 3.52 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|