C19H20ClF3N2O4S — CID 10600232
[(3S,4R)-3-chloro-1-(4-methoxyphenyl)-4-phenylazetidin-2-ylidene]-dimethylazanium;trifluoromethanesulfonate (PubChem CID 10600232) has the molecular formula C19H20ClF3N2O4S and a molecular weight of 464.89 g/mol. Its IUPAC name is [(3S,4R)-3-chloro-1-(4-methoxyphenyl)-4-phenylazetidin-2-ylidene]-dimethylazanium;trifluoromethanesulfonate.
| Compound Name | [(3S,4R)-3-chloro-1-(4-methoxyphenyl)-4-phenylazetidin-2-ylidene]-dimethylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10600232 |
| Molecular Formula | C19H20ClF3N2O4S |
| Molecular Weight | 464.89 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | [(3S,4R)-3-chloro-1-(4-methoxyphenyl)-4-phenylazetidin-2-ylidene]-dimethylazanium;trifluoromethanesulfonate |
| SMILES | COc1ccc(N2C(=[N+](C)C)[C@@H](Cl)[C@H]2c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C18H20ClN2O.CHF3O3S/c1-20(2)18-16(19)17(13-7-5-4-6-8-13)21(18)14-9-11-15(22-3)12-10-14;2-1(3,4)8(5,6)7/h4-12,16-17H,1-3H3;(H,5,6,7)/q+1;/p-1/t16-,17+;/m0./s1 |
| InChIKey | RIIZCPSSMWMTDM-MCJVGQIASA-M |
| XLogP | 3.59 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.89 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|