C18H17NO2 — CID 14068192
(3S,4R)-3-ethenyl-1-(4-methoxyphenyl)-4-phenylazetidin-2-one (PubChem CID 14068192) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is (3S,4R)-3-ethenyl-1-(4-methoxyphenyl)-4-phenylazetidin-2-one.
| Compound Name | (3S,4R)-3-ethenyl-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 14068192 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (3S,4R)-3-ethenyl-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
| SMILES | C=C[C@@H]1C(=O)N(c2ccc(OC)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H17NO2/c1-3-16-17(13-7-5-4-6-8-13)19(18(16)20)14-9-11-15(21-2)12-10-14/h3-12,16-17H,1H2,2H3/t16-,17-/m0/s1 |
| InChIKey | ZUYHBWWGHOKDBS-IRXDYDNUSA-N |
| XLogP | 3.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|