C19H19NO2 — CID 100945342
(3R,4S)-1-(4-methoxyphenyl)-4-phenyl-3-prop-1-en-2-ylazetidin-2-one (PubChem CID 100945342) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (3R,4S)-1-(4-methoxyphenyl)-4-phenyl-3-prop-1-en-2-ylazetidin-2-one.
| Compound Name | (3R,4S)-1-(4-methoxyphenyl)-4-phenyl-3-prop-1-en-2-ylazetidin-2-one |
|---|---|
| PubChem CID | 100945342 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (3R,4S)-1-(4-methoxyphenyl)-4-phenyl-3-prop-1-en-2-ylazetidin-2-one |
| SMILES | C=C(C)[C@H]1C(=O)N(c2ccc(OC)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H19NO2/c1-13(2)17-18(14-7-5-4-6-8-14)20(19(17)21)15-9-11-16(22-3)12-10-15/h4-12,17-18H,1H2,2-3H3/t17-,18-/m1/s1 |
| InChIKey | BZYOWAXDIBMRQL-QZTJIDSGSA-N |
| XLogP | 3.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|