C17H15NO2 — CID 12575792
3-acetyl-1,4-diphenylazetidin-2-one (PubChem CID 12575792) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-acetyl-1,4-diphenylazetidin-2-one.
| Compound Name | 3-acetyl-1,4-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 12575792 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-acetyl-1,4-diphenylazetidin-2-one |
| SMILES | CC(=O)C1C(=O)N(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C17H15NO2/c1-12(19)15-16(13-8-4-2-5-9-13)18(17(15)20)14-10-6-3-7-11-14/h2-11,15-16H,1H3 |
| InChIKey | VCHKZNUEGDWAJD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|