C17H17NO3 — CID 500118
3-(methoxymethoxy)-1,4-diphenylazetidin-2-one (PubChem CID 500118) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-(methoxymethoxy)-1,4-diphenylazetidin-2-one.
| Compound Name | 3-(methoxymethoxy)-1,4-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 500118 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-(methoxymethoxy)-1,4-diphenylazetidin-2-one |
| SMILES | COCOC1C(=O)N(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C17H17NO3/c1-20-12-21-16-15(13-8-4-2-5-9-13)18(17(16)19)14-10-6-3-7-11-14/h2-11,15-16H,12H2,1H3 |
| InChIKey | GFVSKQIIHDRGOK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|