C19H19NO3 — CID 102251895
(3R,4S)-3-[(Z)-2-methoxyethenyl]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one (PubChem CID 102251895) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (3R,4S)-3-[(Z)-2-methoxyethenyl]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one.
| Compound Name | (3R,4S)-3-[(Z)-2-methoxyethenyl]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 102251895 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (3R,4S)-3-[(Z)-2-methoxyethenyl]-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
| SMILES | CO/C=C\[C@H]1C(=O)N(c2ccc(OC)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c1-22-13-12-17-18(14-6-4-3-5-7-14)20(19(17)21)15-8-10-16(23-2)11-9-15/h3-13,17-18H,1-2H3/b13-12-/t17-,18-/m1/s1 |
| InChIKey | ANTIVUIESVSWJD-YXZPIEPFSA-N |
| XLogP | 3.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|