C27H30N2O3 — CID 10574666
(4S,5S)-4-tert-butyl-1,3-bis(4-methoxyphenyl)-5-phenylimidazolidin-2-one (PubChem CID 10574666) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is (4S,5S)-4-tert-butyl-1,3-bis(4-methoxyphenyl)-5-phenylimidazolidin-2-one.
| Compound Name | (4S,5S)-4-tert-butyl-1,3-bis(4-methoxyphenyl)-5-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 10574666 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (4S,5S)-4-tert-butyl-1,3-bis(4-methoxyphenyl)-5-phenylimidazolidin-2-one |
| SMILES | COc1ccc(N2C(=O)N(c3ccc(OC)cc3)[C@@H](C(C)(C)C)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C27H30N2O3/c1-27(2,3)25-24(19-9-7-6-8-10-19)28(20-11-15-22(31-4)16-12-20)26(30)29(25)21-13-17-23(32-5)18-14-21/h6-18,24-25H,1-5H3/t24-,25+/m0/s1 |
| InChIKey | KUCFPZFHNCWUHD-LOSJGSFVSA-N |
| XLogP | 6.31 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |