C31H30N2O5 — CID 11124062
(4R,5R)-1,3,4,5-tetrakis(4-methoxyphenyl)imidazolidin-2-one (PubChem CID 11124062) has the molecular formula C31H30N2O5 and a molecular weight of 510.59 g/mol. Its IUPAC name is (4R,5R)-1,3,4,5-tetrakis(4-methoxyphenyl)imidazolidin-2-one.
| Compound Name | (4R,5R)-1,3,4,5-tetrakis(4-methoxyphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 11124062 |
| Molecular Formula | C31H30N2O5 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (4R,5R)-1,3,4,5-tetrakis(4-methoxyphenyl)imidazolidin-2-one |
| SMILES | COc1ccc([C@@H]2[C@@H](c3ccc(OC)cc3)N(c3ccc(OC)cc3)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H30N2O5/c1-35-25-13-5-21(6-14-25)29-30(22-7-15-26(36-2)16-8-22)33(24-11-19-28(38-4)20-12-24)31(34)32(29)23-9-17-27(37-3)18-10-23/h5-20,29-30H,1-4H3/t29-,30-/m1/s1 |
| InChIKey | HWJDDRYUCWXZON-LOYHVIPDSA-N |
| XLogP | 6.65 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |