C18H19NO4S — CID 53493590
(3S,4R)-1,4-bis(4-methoxyphenyl)-3-methylsulfinylazetidin-2-one (PubChem CID 53493590) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is (3S,4R)-1,4-bis(4-methoxyphenyl)-3-methylsulfinylazetidin-2-one.
| Compound Name | (3S,4R)-1,4-bis(4-methoxyphenyl)-3-methylsulfinylazetidin-2-one |
|---|---|
| PubChem CID | 53493590 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (3S,4R)-1,4-bis(4-methoxyphenyl)-3-methylsulfinylazetidin-2-one |
| SMILES | COc1ccc([C@@H]2[C@H](S(C)=O)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-22-14-8-4-12(5-9-14)16-17(24(3)21)18(20)19(16)13-6-10-15(23-2)11-7-13/h4-11,16-17H,1-3H3/t16-,17+,24?/m1/s1 |
| InChIKey | FRAWBWPTORAOMG-GZGKXBPWSA-N |
| XLogP | 2.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |