C23H21NO5 — CID 102273363
(3R,4S)-3-(4-hydroxyphenoxy)-1,4-bis(4-methoxyphenyl)azetidin-2-one (PubChem CID 102273363) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is (3R,4S)-3-(4-hydroxyphenoxy)-1,4-bis(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3R,4S)-3-(4-hydroxyphenoxy)-1,4-bis(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 102273363 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (3R,4S)-3-(4-hydroxyphenoxy)-1,4-bis(4-methoxyphenyl)azetidin-2-one |
| SMILES | COc1ccc([C@H]2[C@@H](Oc3ccc(O)cc3)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H21NO5/c1-27-18-9-3-15(4-10-18)21-22(29-20-13-7-17(25)8-14-20)23(26)24(21)16-5-11-19(28-2)12-6-16/h3-14,21-22,25H,1-2H3/t21-,22+/m0/s1 |
| InChIKey | XRZPFSYQEJSIFF-FCHUYYIVSA-N |
| XLogP | 3.94 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |