C23H21NO3 — CID 101388237
(3R,4S)-1,4-bis(4-methoxyphenyl)-3-phenylazetidin-2-one (PubChem CID 101388237) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is (3R,4S)-1,4-bis(4-methoxyphenyl)-3-phenylazetidin-2-one.
| Compound Name | (3R,4S)-1,4-bis(4-methoxyphenyl)-3-phenylazetidin-2-one |
|---|---|
| PubChem CID | 101388237 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (3R,4S)-1,4-bis(4-methoxyphenyl)-3-phenylazetidin-2-one |
| SMILES | COc1ccc([C@@H]2[C@@H](c3ccccc3)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H21NO3/c1-26-19-12-8-17(9-13-19)22-21(16-6-4-3-5-7-16)23(25)24(22)18-10-14-20(27-2)15-11-18/h3-15,21-22H,1-2H3/t21-,22-/m1/s1 |
| InChIKey | UAWKPWTZGCUZDJ-FGZHOGPDSA-N |
| XLogP | 4.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |